About CID 150343713
CID 150343713 (PubChem CID 150343713) has the molecular formula C20H27O2Sn
and a molecular weight of 418.15 g/mol.
Molecular Properties
| Compound Name | CID 150343713 |
| PubChem CID | 150343713 |
| Molecular Formula | C20H27O2Sn |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](OCCc1ccccc1)OCCc1ccccc1 |
| InChI | InChI=1S/2C8H9O.C4H9.Sn/c2*9-7-6-8-4-2-1-3-5-8;1-3-4-2;/h2*1-5H,6-7H2;1,3-4H2,2H3;/q2*-1;;+2 |
| InChIKey | GSFXZMLEBZTPHI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 150343713 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150343713?
The IUPAC name of CID 150343713 (CID 150343713) is not available.
What is the SMILES notation for CID 150343713?
The canonical SMILES for CID 150343713 is CCCC[Sn](OCCc1ccccc1)OCCc1ccccc1.
What is the InChIKey of CID 150343713?
The InChIKey is GSFXZMLEBZTPHI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H9O.C4H9.Sn/c2*9-7-6-8-4-2-1-3-5-8;1-3-4-2;/h2*1-5H,6-7H2;1,3-4H2,2H3;/q2*-1;;+2.
What are the key properties of CID 150343713?
CID 150343713 has a molecular weight of 418.15 g/mol, XLogP of 4.79, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150343713 is sourced from PubChem (CID 150343713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).