4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid

C4H3FO5 — CID 150344260

IUPAC4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid
SMILESO=C1OCC(F)(C(=O)O)O1
InChIInChI=1S/C4H3FO5/c5-4(2(6)7)1-9-3(8)10-4/h1H2,(H,6,7)
InChIKeyGSIWDTMFJNAHOE-UHFFFAOYSA-N
MW150.06 g/mol
LogP-0.10
Rot. Bonds1

About 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid

4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid (PubChem CID 150344260) has the molecular formula C4H3FO5 and a molecular weight of 150.06 g/mol. Its IUPAC name is 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid.

Molecular Properties

Compound Name4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid
PubChem CID150344260
Molecular FormulaC4H3FO5
Molecular Weight150.06 g/mol
Exact Mass150.00
IUPAC Name4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid
SMILESO=C1OCC(F)(C(=O)O)O1
InChIInChI=1S/C4H3FO5/c5-4(2(6)7)1-9-3(8)10-4/h1H2,(H,6,7)
InChIKeyGSIWDTMFJNAHOE-UHFFFAOYSA-N
XLogP-0.10
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.06
LogP ≤ 5-0.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid (CID 150344260) is 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid is O=C1OCC(F)(C(=O)O)O1.
What is the InChIKey of 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid?
The InChIKey is GSIWDTMFJNAHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FO5/c5-4(2(6)7)1-9-3(8)10-4/h1H2,(H,6,7).
What are the key properties of 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid?
4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid has a molecular weight of 150.06 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-oxo-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 150344260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).