C7H15NO4 — CID 150344667
(2S)-4-hydroxy-2-[hydroxy(propyl)amino]butanoic acid (PubChem CID 150344667) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[hydroxy(propyl)amino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[hydroxy(propyl)amino]butanoic acid |
|---|---|
| PubChem CID | 150344667 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (2S)-4-hydroxy-2-[hydroxy(propyl)amino]butanoic acid |
| SMILES | CCCN(O)[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C7H15NO4/c1-2-4-8(12)6(3-5-9)7(10)11/h6,9,12H,2-5H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | GSKZTSDUYIGYJY-LURJTMIESA-N |
| XLogP | -0.08 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|