C28H26Cl4N2O3S2 — CID 150345219
3-[5-[(2,4-dichlorophenyl)methyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylpropanamide (PubChem CID 150345219) has the molecular formula C28H26Cl4N2O3S2 and a molecular weight of 644.47 g/mol. Its IUPAC name is 3-[5-[(2,4-dichlorophenyl)methyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylpropanamide.
| Compound Name | 3-[5-[(2,4-dichlorophenyl)methyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylpropanamide |
|---|---|
| PubChem CID | 150345219 |
| Molecular Formula | C28H26Cl4N2O3S2 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 642.01 |
| IUPAC Name | 3-[5-[(2,4-dichlorophenyl)methyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indol-4-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylpropanamide |
| SMILES | O=C(CCc1cccc2c3c(n(Cc4ccc(Cl)cc4Cl)c12)CCCCCC3)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C28H26Cl4N2O3S2/c29-19-12-10-18(22(30)14-19)16-34-24-9-4-2-1-3-7-20(24)21-8-5-6-17(27(21)34)11-13-25(35)33-39(36,37)26-15-23(31)28(32)38-26/h5-6,8,10,12,14-15H,1-4,7,9,11,13,16H2,(H,33,35) |
| InChIKey | GSOBSJDOLDRKCE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|