About N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine
N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine (PubChem CID 150346184) has the molecular formula C22H45NO2
and a molecular weight of 355.61 g/mol. Its IUPAC name is N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine |
| PubChem CID | 150346184 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine |
| SMILES | CCCCCCCCC(CNC1CCCCC1)C(C)(OCC)OCC |
| InChI | InChI=1S/C22H45NO2/c1-5-8-9-10-11-13-16-20(22(4,24-6-2)25-7-3)19-23-21-17-14-12-15-18-21/h20-21,23H,5-19H2,1-4H3 |
| InChIKey | GSTLZIVLECWVMP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine?
The IUPAC name of N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine (CID 150346184) is N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine.
What is the SMILES notation for N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine?
The canonical SMILES for N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine is CCCCCCCCC(CNC1CCCCC1)C(C)(OCC)OCC.
What is the InChIKey of N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine?
The InChIKey is GSTLZIVLECWVMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45NO2/c1-5-8-9-10-11-13-16-20(22(4,24-6-2)25-7-3)19-23-21-17-14-12-15-18-21/h20-21,23H,5-19H2,1-4H3.
What are the key properties of N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine?
N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine has a molecular weight of 355.61 g/mol, XLogP of 6.06, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,1-diethoxyethyl)decyl]cyclohexanamine is sourced from PubChem (CID 150346184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).