About (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate
(5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate (PubChem CID 150346316) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate.
Molecular Properties
| Compound Name | (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate |
| PubChem CID | 150346316 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate |
| SMILES | CCC(=O)OCn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-3-7(12)15-5-11-4-6(2)8(13)10-9(11)14/h4H,3,5H2,1-2H3,(H,10,13,14) |
| InChIKey | GSUASMZAUPQOGP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate?
The IUPAC name of (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate (CID 150346316) is (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate.
What is the SMILES notation for (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate?
The canonical SMILES for (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate is CCC(=O)OCn1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate?
The InChIKey is GSUASMZAUPQOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-3-7(12)15-5-11-4-6(2)8(13)10-9(11)14/h4H,3,5H2,1-2H3,(H,10,13,14).
What are the key properties of (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate?
(5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate has a molecular weight of 212.20 g/mol, XLogP of -0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2,4-dioxopyrimidin-1-yl)methyl propanoate is sourced from PubChem (CID 150346316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).