About N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine
N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine (PubChem CID 150347426) has the molecular formula C22H48N2O2
and a molecular weight of 372.64 g/mol. Its IUPAC name is N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine.
Molecular Properties
| Compound Name | N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine |
| PubChem CID | 150347426 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine |
| SMILES | CCCCCCCCC(CCCNCCCCCCN)C(C)(OC)OC |
| InChI | InChI=1S/C22H48N2O2/c1-5-6-7-8-9-12-16-21(22(2,25-3)26-4)17-15-20-24-19-14-11-10-13-18-23/h21,24H,5-20,23H2,1-4H3 |
| InChIKey | GSZXGOUNYHAETO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine?
The IUPAC name of N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine (CID 150347426) is N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine.
What is the SMILES notation for N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine?
The canonical SMILES for N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine is CCCCCCCCC(CCCNCCCCCCN)C(C)(OC)OC.
What is the InChIKey of N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine?
The InChIKey is GSZXGOUNYHAETO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N2O2/c1-5-6-7-8-9-12-16-21(22(2,25-3)26-4)17-15-20-24-19-14-11-10-13-18-23/h21,24H,5-20,23H2,1-4H3.
What are the key properties of N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine?
N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine has a molecular weight of 372.64 g/mol, XLogP of 5.25, 20 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(1,1-dimethoxyethyl)dodecyl]hexane-1,6-diamine is sourced from PubChem (CID 150347426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).