About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate (PubChem CID 15034748) has the molecular formula C18H24O6
and a molecular weight of 336.38 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate |
| PubChem CID | 15034748 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate |
| SMILES | CC1(C)OCC(COC(=O)CCc2ccc(OCC3CO3)cc2)O1 |
| InChI | InChI=1S/C18H24O6/c1-18(2)23-12-16(24-18)11-22-17(19)8-5-13-3-6-14(7-4-13)20-9-15-10-21-15/h3-4,6-7,15-16H,5,8-12H2,1-2H3 |
| InChIKey | KRWYNMRVFUJBLH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate (CID 15034748) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate is CC1(C)OCC(COC(=O)CCc2ccc(OCC3CO3)cc2)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate?
The InChIKey is KRWYNMRVFUJBLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O6/c1-18(2)23-12-16(24-18)11-22-17(19)8-5-13-3-6-14(7-4-13)20-9-15-10-21-15/h3-4,6-7,15-16H,5,8-12H2,1-2H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate has a molecular weight of 336.38 g/mol, XLogP of 2.09, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate is sourced from PubChem (CID 15034748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).