About cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone
cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone (PubChem CID 150350050) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone |
| PubChem CID | 150350050 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone |
| SMILES | COC1(C(=O)C2CC2)C=CC=C1 |
| InChI | InChI=1S/C10H12O2/c1-12-10(6-2-3-7-10)9(11)8-4-5-8/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | GTNXMORPLQAABX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The IUPAC name of cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone (CID 150350050) is cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone.
What is the SMILES notation for cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The canonical SMILES for cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone is COC1(C(=O)C2CC2)C=CC=C1.
What is the InChIKey of cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The InChIKey is GTNXMORPLQAABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-12-10(6-2-3-7-10)9(11)8-4-5-8/h2-3,6-8H,4-5H2,1H3.
What are the key properties of cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone has a molecular weight of 164.20 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone is sourced from PubChem (CID 150350050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).