C24H36FN3O4SSi — CID 150350992
5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one (PubChem CID 150350992) has the molecular formula C24H36FN3O4SSi and a molecular weight of 509.72 g/mol. Its IUPAC name is 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one.
| Compound Name | 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one |
|---|---|
| PubChem CID | 150350992 |
| Molecular Formula | C24H36FN3O4SSi |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-fluorophenyl)methyl]pyrazin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1cn(Cc2ccc(F)cc2)c(=O)c(N2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C24H36FN3O4SSi/c1-24(2,3)34(4,5)32-14-6-7-21-18-28(17-19-8-10-20(25)11-9-19)23(29)22(26-21)27-12-15-33(30,31)16-13-27/h8-11,18H,6-7,12-17H2,1-5H3 |
| InChIKey | GTSSAVGERFZXLL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|