C32H36ClN3O2 — CID 15035155
1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)urea (PubChem CID 15035155) has the molecular formula C32H36ClN3O2 and a molecular weight of 530.11 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)urea.
| Compound Name | 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 15035155 |
| Molecular Formula | C32H36ClN3O2 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)urea |
| SMILES | Cc1cc(C)c2ncc(NC(=O)Nc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C32H36ClN3O2/c1-18-13-19(2)28-22(14-18)27(21-11-9-10-12-25(21)33)26(17-34-28)36-30(38)35-20-15-23(31(3,4)5)29(37)24(16-20)32(6,7)8/h9-17,37H,1-8H3,(H2,35,36,38) |
| InChIKey | GHHZCUZAQLSWRH-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|