C30H32ClN3O2 — CID 15035167
1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]urea (PubChem CID 15035167) has the molecular formula C30H32ClN3O2 and a molecular weight of 502.06 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 15035167 |
| Molecular Formula | C30H32ClN3O2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]urea |
| SMILES | Cc1cc(C)c2ncc(NC(=O)Nc3cc(C(C)C)c(O)c(C(C)C)c3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C30H32ClN3O2/c1-16(2)22-13-20(14-23(17(3)4)29(22)35)33-30(36)34-26-15-32-28-19(6)11-18(5)12-24(28)27(26)21-9-7-8-10-25(21)31/h7-17,35H,1-6H3,(H2,33,34,36) |
| InChIKey | LPOPKNZONXDRJH-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|