About 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole
6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole (PubChem CID 150353289) has the molecular formula C16H13N3OS
and a molecular weight of 295.37 g/mol. Its IUPAC name is 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole |
| PubChem CID | 150353289 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole |
| SMILES | COC(c1ccc2ncsc2c1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C16H13N3OS/c1-20-15(10-4-5-13-14(7-10)21-9-19-13)12-8-18-16-11(12)3-2-6-17-16/h2-9,15H,1H3,(H,17,18) |
| InChIKey | GUEPJYPJGFDCBT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole?
The IUPAC name of 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole (CID 150353289) is 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole.
What is the SMILES notation for 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole?
The canonical SMILES for 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole is COC(c1ccc2ncsc2c1)c1c[nH]c2ncccc12.
What is the InChIKey of 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole?
The InChIKey is GUEPJYPJGFDCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3OS/c1-20-15(10-4-5-13-14(7-10)21-9-19-13)12-8-18-16-11(12)3-2-6-17-16/h2-9,15H,1H3,(H,17,18).
What are the key properties of 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole?
6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole has a molecular weight of 295.37 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[methoxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1,3-benzothiazole is sourced from PubChem (CID 150353289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).