C24H32O2 — CID 150354907
2,6-diethyl-4-(2,2,4,6,8-pentamethyl-3H-chromen-4-yl)phenol (PubChem CID 150354907) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2,6-diethyl-4-(2,2,4,6,8-pentamethyl-3H-chromen-4-yl)phenol.
| Compound Name | 2,6-diethyl-4-(2,2,4,6,8-pentamethyl-3H-chromen-4-yl)phenol |
|---|---|
| PubChem CID | 150354907 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2,6-diethyl-4-(2,2,4,6,8-pentamethyl-3H-chromen-4-yl)phenol |
| SMILES | CCc1cc(C2(C)CC(C)(C)Oc3c(C)cc(C)cc32)cc(CC)c1O |
| InChI | InChI=1S/C24H32O2/c1-8-17-12-19(13-18(9-2)21(17)25)24(7)14-23(5,6)26-22-16(4)10-15(3)11-20(22)24/h10-13,25H,8-9,14H2,1-7H3 |
| InChIKey | GUMWRQRMPBEKBX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |