C20H20F3N5O2 — CID 15035599
4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-one (PubChem CID 15035599) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 15035599 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(-c2ccc(N3CCN(c4ccc(O)cc4)CC3)cc2)cnn1CC(F)(F)F |
| InChI | InChI=1S/C20H20F3N5O2/c21-20(22,23)13-28-19(30)27(14-24-28)17-3-1-15(2-4-17)25-9-11-26(12-10-25)16-5-7-18(29)8-6-16/h1-8,14,29H,9-13H2 |
| InChIKey | AUKPGBCFNMXRKW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|