C14H11F7OS — CID 15035997
6-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2,2-dimethylchromene (PubChem CID 15035997) has the molecular formula C14H11F7OS and a molecular weight of 360.29 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2,2-dimethylchromene.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2,2-dimethylchromene |
|---|---|
| PubChem CID | 15035997 |
| Molecular Formula | C14H11F7OS |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2,2-dimethylchromene |
| SMILES | CC1(C)C=Cc2cc(SC(F)(F)C(F)(F)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C14H11F7OS/c1-11(2)6-5-8-7-9(3-4-10(8)22-11)23-14(20,21)12(15,16)13(17,18)19/h3-7H,1-2H3 |
| InChIKey | ANDVJMPVHGERHU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|