C15H20BNO2 — CID 150362367
7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methyl-2H-quinoline (PubChem CID 150362367) has the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. Its IUPAC name is 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methyl-2H-quinoline.
| Compound Name | 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methyl-2H-quinoline |
|---|---|
| PubChem CID | 150362367 |
| Molecular Formula | C15H20BNO2 |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methyl-2H-quinoline |
| SMILES | CN1CC=Cc2ccc(B3OCC(C)(C)CO3)cc21 |
| InChI | InChI=1S/C15H20BNO2/c1-15(2)10-18-16(19-11-15)13-7-6-12-5-4-8-17(3)14(12)9-13/h4-7,9H,8,10-11H2,1-3H3 |
| InChIKey | GVZAMSROWNSILP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|