C11H11Cl2N3O — CID 15036415
2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-1-ol (PubChem CID 15036415) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-1-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 15036415 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-1-ol |
| SMILES | OCC(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O/c12-9-1-2-10(11(13)3-9)8(5-17)4-16-7-14-6-15-16/h1-3,6-8,17H,4-5H2 |
| InChIKey | QMUIPLNEIWEBJS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |