About 2,3-dibromopropylphosphane
2,3-dibromopropylphosphane (PubChem CID 150365341) has the molecular formula C3H7Br2P
and a molecular weight of 233.87 g/mol. Its IUPAC name is 2,3-dibromopropylphosphane.
Molecular Properties
| Compound Name | 2,3-dibromopropylphosphane |
| PubChem CID | 150365341 |
| Molecular Formula | C3H7Br2P |
| Molecular Weight | 233.87 g/mol |
| Exact Mass | 231.87 |
| IUPAC Name | 2,3-dibromopropylphosphane |
| SMILES | PCC(Br)CBr |
| InChI | InChI=1S/C3H7Br2P/c4-1-3(5)2-6/h3H,1-2,6H2 |
| InChIKey | YTXKTCHDQOHXDG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.87 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromopropylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromopropylphosphane?
The IUPAC name of 2,3-dibromopropylphosphane (CID 150365341) is 2,3-dibromopropylphosphane.
What is the SMILES notation for 2,3-dibromopropylphosphane?
The canonical SMILES for 2,3-dibromopropylphosphane is PCC(Br)CBr.
What is the InChIKey of 2,3-dibromopropylphosphane?
The InChIKey is YTXKTCHDQOHXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7Br2P/c4-1-3(5)2-6/h3H,1-2,6H2.
What are the key properties of 2,3-dibromopropylphosphane?
2,3-dibromopropylphosphane has a molecular weight of 233.87 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromopropylphosphane is sourced from PubChem (CID 150365341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).