C33H47N5O3 — CID 150365741
7-(cyclopropylmethoxy)-6-N-[4-[2-methoxyethyl(methyl)amino]-1-pentoxybut-2-enyl]-4-N-[(1R)-1-phenylethyl]quinazoline-4,6-diamine (PubChem CID 150365741) has the molecular formula C33H47N5O3 and a molecular weight of 561.77 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-6-N-[4-[2-methoxyethyl(methyl)amino]-1-pentoxybut-2-enyl]-4-N-[(1R)-1-phenylethyl]quinazoline-4,6-diamine.
| Compound Name | 7-(cyclopropylmethoxy)-6-N-[4-[2-methoxyethyl(methyl)amino]-1-pentoxybut-2-enyl]-4-N-[(1R)-1-phenylethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 150365741 |
| Molecular Formula | C33H47N5O3 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.37 |
| IUPAC Name | 7-(cyclopropylmethoxy)-6-N-[4-[2-methoxyethyl(methyl)amino]-1-pentoxybut-2-enyl]-4-N-[(1R)-1-phenylethyl]quinazoline-4,6-diamine |
| SMILES | CCCCCOC(C=CCN(C)CCOC)Nc1cc2c(N[C@H](C)c3ccccc3)ncnc2cc1OCC1CC1 |
| InChI | InChI=1S/C33H47N5O3/c1-5-6-10-19-40-32(14-11-17-38(3)18-20-39-4)37-30-21-28-29(22-31(30)41-23-26-15-16-26)34-24-35-33(28)36-25(2)27-12-8-7-9-13-27/h7-9,11-14,21-22,24-26,32,37H,5-6,10,15-20,23H2,1-4H3,(H,34,35,36)/t25-,32?/m1/s1 |
| InChIKey | GWRCRVRSKHNLCQ-LYYPKXFYSA-N |
| XLogP | 6.67 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|