C28H27FN4O2S — CID 150366910
6-[5-(2-fluoro-4-methoxyphenyl)thiophen-2-yl]-1-methyl-2-(3-phenylmethoxypropyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 150366910) has the molecular formula C28H27FN4O2S and a molecular weight of 502.62 g/mol. Its IUPAC name is 6-[5-(2-fluoro-4-methoxyphenyl)thiophen-2-yl]-1-methyl-2-(3-phenylmethoxypropyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 6-[5-(2-fluoro-4-methoxyphenyl)thiophen-2-yl]-1-methyl-2-(3-phenylmethoxypropyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 150366910 |
| Molecular Formula | C28H27FN4O2S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 6-[5-(2-fluoro-4-methoxyphenyl)thiophen-2-yl]-1-methyl-2-(3-phenylmethoxypropyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | COc1ccc(-c2ccc(-c3cc4c(nc(CCCOCc5ccccc5)n4C)c(N)n3)s2)c(F)c1 |
| InChI | InChI=1S/C28H27FN4O2S/c1-33-23-16-22(25-13-12-24(36-25)20-11-10-19(34-2)15-21(20)29)31-28(30)27(23)32-26(33)9-6-14-35-17-18-7-4-3-5-8-18/h3-5,7-8,10-13,15-16H,6,9,14,17H2,1-2H3,(H2,30,31) |
| InChIKey | GWXGYCMFSMOCKR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|