C17H21ClN2O — CID 150370518
4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridin-4-ylpyridine (PubChem CID 150370518) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridin-4-ylpyridine.
| Compound Name | 4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 150370518 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridin-4-ylpyridine |
| SMILES | CC(C)C[C@H](C)COc1cnc(-c2ccncc2)cc1Cl |
| InChI | InChI=1S/C17H21ClN2O/c1-12(2)8-13(3)11-21-17-10-20-16(9-15(17)18)14-4-6-19-7-5-14/h4-7,9-10,12-13H,8,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | GXQDEZCGHSUKOB-ZDUSSCGKSA-N |
| XLogP | 4.86 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |