C14H30O2Si — CID 150371116
4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-1-ol (PubChem CID 150371116) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-1-ol |
|---|---|
| PubChem CID | 150371116 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-2-en-1-ol |
| SMILES | CCCC(C)(C=CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-8-10-14(5,11-9-12-15)16-17(6,7)13(2,3)4/h9,11,15H,8,10,12H2,1-7H3 |
| InChIKey | GXTCYQPQQFWOHS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|