About ethyl 2-bromo-5-fluorobenzoate
ethyl 2-bromo-5-fluorobenzoate (PubChem CID 15037299) has the molecular formula C9H8BrFO2
and a molecular weight of 247.06 g/mol. Its IUPAC name is ethyl 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | ethyl 2-bromo-5-fluorobenzoate |
| PubChem CID | 15037299 |
| Molecular Formula | C9H8BrFO2 |
| Molecular Weight | 247.06 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | ethyl 2-bromo-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C9H8BrFO2/c1-2-13-9(12)7-5-6(11)3-4-8(7)10/h3-5H,2H2,1H3 |
| InChIKey | ODFAIHQRCRQZGM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-5-fluorobenzoate?
The IUPAC name of ethyl 2-bromo-5-fluorobenzoate (CID 15037299) is ethyl 2-bromo-5-fluorobenzoate.
What is the SMILES notation for ethyl 2-bromo-5-fluorobenzoate?
The canonical SMILES for ethyl 2-bromo-5-fluorobenzoate is CCOC(=O)c1cc(F)ccc1Br.
What is the InChIKey of ethyl 2-bromo-5-fluorobenzoate?
The InChIKey is ODFAIHQRCRQZGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrFO2/c1-2-13-9(12)7-5-6(11)3-4-8(7)10/h3-5H,2H2,1H3.
What are the key properties of ethyl 2-bromo-5-fluorobenzoate?
ethyl 2-bromo-5-fluorobenzoate has a molecular weight of 247.06 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 15037299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).