C31H40N6O5 — CID 150374751
N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-methoxy-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 150374751) has the molecular formula C31H40N6O5 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-methoxy-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-methoxy-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 150374751 |
| Molecular Formula | C31H40N6O5 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-methoxy-5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCN1CCN(Cc2ccc(Nc3nc(OC)c4c(-c5ccc(OCOCCOC)c(OC)c5)c[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C31H40N6O5/c1-5-36-12-14-37(15-13-36)20-22-6-9-24(10-7-22)33-31-34-29-28(30(35-31)40-4)25(19-32-29)23-8-11-26(27(18-23)39-3)42-21-41-17-16-38-2/h6-11,18-19H,5,12-17,20-21H2,1-4H3,(H2,32,33,34,35) |
| InChIKey | GYLJUKWLPMHVRN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|