C57H66N8O5 — CID 150377033
2,4-bis[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1,5-bis[1-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pentan-3-one (PubChem CID 150377033) has the molecular formula C57H66N8O5 and a molecular weight of 943.21 g/mol. Its IUPAC name is 2,4-bis[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1,5-bis[1-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1,5-bis[1-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pentan-3-one |
|---|---|
| PubChem CID | 150377033 |
| Molecular Formula | C57H66N8O5 |
| Molecular Weight | 943.21 g/mol |
| Exact Mass | 942.52 |
| IUPAC Name | 2,4-bis[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1,5-bis[1-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pentan-3-one |
| SMILES | Cc1ccc(C2c3cccn3CCN2CC(C(=O)C(CN2CCn3cccc3C2c2ccc(C)cc2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C57H66N8O5/c1-41-7-13-45(14-8-41)55-47-5-3-19-60(47)29-31-64(55)37-49(62-25-21-58(22-26-62)35-43-11-17-51-53(33-43)69-39-67-51)57(66)50(63-27-23-59(24-28-63)36-44-12-18-52-54(34-44)70-40-68-52)38-65-32-30-61-20-4-6-48(61)56(65)46-15-9-42(2)10-16-46/h3-20,33-34,49-50,55-56H,21-32,35-40H2,1-2H3 |
| InChIKey | GYXMXVQCSXLMQR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.21 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |