C8H4Cl4F8 — CID 150379236
2,3,4,4-tetrachloro-1,5,6,6,7,8,8,8-octafluorooct-1-ene (PubChem CID 150379236) has the molecular formula C8H4Cl4F8 and a molecular weight of 393.92 g/mol. Its IUPAC name is 2,3,4,4-tetrachloro-1,5,6,6,7,8,8,8-octafluorooct-1-ene.
| Compound Name | 2,3,4,4-tetrachloro-1,5,6,6,7,8,8,8-octafluorooct-1-ene |
|---|---|
| PubChem CID | 150379236 |
| Molecular Formula | C8H4Cl4F8 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 2,3,4,4-tetrachloro-1,5,6,6,7,8,8,8-octafluorooct-1-ene |
| SMILES | FC=C(Cl)C(Cl)C(Cl)(Cl)C(F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl4F8/c9-2(1-13)3(10)6(11,12)4(14)7(16,17)5(15)8(18,19)20/h1,3-5H |
| InChIKey | GZJDGSLAIPPYAN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|