About 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene
2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene (PubChem CID 150379406) has the molecular formula C13H13F4NO
and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene.
Molecular Properties
| Compound Name | 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene |
| PubChem CID | 150379406 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene |
| SMILES | O=C=Nc1ccc(CCCCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H13F4NO/c14-12-8-11(18-9-19)6-5-10(12)4-2-1-3-7-13(15,16)17/h5-6,8H,1-4,7H2 |
| InChIKey | GZJYRLMVVYHLAP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene?
The IUPAC name of 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene (CID 150379406) is 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene.
What is the SMILES notation for 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene?
The canonical SMILES for 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene is O=C=Nc1ccc(CCCCCC(F)(F)F)c(F)c1.
What is the InChIKey of 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene?
The InChIKey is GZJYRLMVVYHLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F4NO/c14-12-8-11(18-9-19)6-5-10(12)4-2-1-3-7-13(15,16)17/h5-6,8H,1-4,7H2.
What are the key properties of 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene?
2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene has a molecular weight of 275.25 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-isocyanato-1-(6,6,6-trifluorohexyl)benzene is sourced from PubChem (CID 150379406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).