C9H13BN2O8 — CID 15037955
[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]boronic acid (PubChem CID 15037955) has the molecular formula C9H13BN2O8 and a molecular weight of 288.02 g/mol. Its IUPAC name is [1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]boronic acid.
| Compound Name | [1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 15037955 |
| Molecular Formula | C9H13BN2O8 |
| Molecular Weight | 288.02 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]boronic acid |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1B(O)O |
| InChI | InChI=1S/C9H13BN2O8/c13-2-4-5(14)6(15)8(20-4)12-1-3(10(18)19)7(16)11-9(12)17/h1,4-6,8,13-15,18-19H,2H2,(H,11,16,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | SISHHZLTFYROTH-UAKXSSHOSA-N |
| XLogP | -5.17 |
| TPSA | 165.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.02 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|