C17H15FN6OS — CID 150380237
4-(4-amino-5-ethylsulfanyl-2-fluorophenyl)-7-(1H-pyrazol-4-yl)-[1,2]oxazolo[4,5-c]pyridin-3-amine (PubChem CID 150380237) has the molecular formula C17H15FN6OS and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-(4-amino-5-ethylsulfanyl-2-fluorophenyl)-7-(1H-pyrazol-4-yl)-[1,2]oxazolo[4,5-c]pyridin-3-amine.
| Compound Name | 4-(4-amino-5-ethylsulfanyl-2-fluorophenyl)-7-(1H-pyrazol-4-yl)-[1,2]oxazolo[4,5-c]pyridin-3-amine |
|---|---|
| PubChem CID | 150380237 |
| Molecular Formula | C17H15FN6OS |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(4-amino-5-ethylsulfanyl-2-fluorophenyl)-7-(1H-pyrazol-4-yl)-[1,2]oxazolo[4,5-c]pyridin-3-amine |
| SMILES | CCSc1cc(-c2ncc(-c3cn[nH]c3)c3onc(N)c23)c(F)cc1N |
| InChI | InChI=1S/C17H15FN6OS/c1-2-26-13-3-9(11(18)4-12(13)19)15-14-16(25-24-17(14)20)10(7-21-15)8-5-22-23-6-8/h3-7H,2,19H2,1H3,(H2,20,24)(H,22,23) |
| InChIKey | GZOSBWSAZZJQOM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|