C18H30O6 — CID 15038222
(2R,3S,4S,5R)-1,2,5,6-tetrakis(prop-2-enoxy)hexane-3,4-diol (PubChem CID 15038222) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,2,5,6-tetrakis(prop-2-enoxy)hexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis(prop-2-enoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 15038222 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (2R,3S,4S,5R)-1,2,5,6-tetrakis(prop-2-enoxy)hexane-3,4-diol |
| SMILES | C=CCOC[C@@H](OCC=C)[C@@H](O)[C@H](O)[C@@H](COCC=C)OCC=C |
| InChI | InChI=1S/C18H30O6/c1-5-9-21-13-15(23-11-7-3)17(19)18(20)16(24-12-8-4)14-22-10-6-2/h5-8,15-20H,1-4,9-14H2/t15-,16-,17-,18-/m1/s1 |
| InChIKey | UMWUJSTZILXNOY-BRSBDYLESA-N |
| XLogP | 1.26 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|