C30H41ClFN5O4Si — CID 150383015
N-[(1S)-1-[5-chloro-2-(2-fluorophenyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1-methylazetidine-3-carboxamide (PubChem CID 150383015) has the molecular formula C30H41ClFN5O4Si and a molecular weight of 618.23 g/mol. Its IUPAC name is N-[(1S)-1-[5-chloro-2-(2-fluorophenyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1-methylazetidine-3-carboxamide.
| Compound Name | N-[(1S)-1-[5-chloro-2-(2-fluorophenyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 150383015 |
| Molecular Formula | C30H41ClFN5O4Si |
| Molecular Weight | 618.23 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | N-[(1S)-1-[5-chloro-2-(2-fluorophenyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1-methylazetidine-3-carboxamide |
| SMILES | CN1CC(C(=O)N[C@@H](CCCCCC(=O)c2ccon2)c2c(Cl)nc(-c3ccccc3F)n2COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C30H41ClFN5O4Si/c1-36-18-21(19-36)30(39)33-25(12-6-5-7-13-26(38)24-14-15-41-35-24)27-28(31)34-29(22-10-8-9-11-23(22)32)37(27)20-40-16-17-42(2,3)4/h8-11,14-15,21,25H,5-7,12-13,16-20H2,1-4H3,(H,33,39)/t25-/m0/s1 |
| InChIKey | HACZXGUAIAOELA-VWLOTQADSA-N |
| XLogP | 6.20 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.23 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|