About 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole
2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole (PubChem CID 150383648) has the molecular formula C32H27N
and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole.
Molecular Properties
| Compound Name | 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole |
| PubChem CID | 150383648 |
| Molecular Formula | C32H27N |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole |
| SMILES | CCc1cc(-c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)c[nH]1 |
| InChI | InChI=1S/C32H27N/c1-2-30-22-29(23-33-30)24-18-20-28(21-19-24)32(27-16-10-5-11-17-27)31(25-12-6-3-7-13-25)26-14-8-4-9-15-26/h3-23,33H,2H2,1H3 |
| InChIKey | HAGIJWLKOGIKEO-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole?
The IUPAC name of 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole (CID 150383648) is 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole.
What is the SMILES notation for 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole?
The canonical SMILES for 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole is CCc1cc(-c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)c[nH]1.
What is the InChIKey of 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole?
The InChIKey is HAGIJWLKOGIKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H27N/c1-2-30-22-29(23-33-30)24-18-20-28(21-19-24)32(27-16-10-5-11-17-27)31(25-12-6-3-7-13-25)26-14-8-4-9-15-26/h3-23,33H,2H2,1H3.
What are the key properties of 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole?
2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole has a molecular weight of 425.58 g/mol, XLogP of 8.25, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[4-(1,2,2-triphenylethenyl)phenyl]-1H-pyrrole is sourced from PubChem (CID 150383648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).