C15H18 — CID 150384285
4-methyl-1,2,3,4,4a,10-hexahydroanthracene (PubChem CID 150384285) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-methyl-1,2,3,4,4a,10-hexahydroanthracene.
| Compound Name | 4-methyl-1,2,3,4,4a,10-hexahydroanthracene |
|---|---|
| PubChem CID | 150384285 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-methyl-1,2,3,4,4a,10-hexahydroanthracene |
| SMILES | CC1CCCC2=Cc3ccccc3CC21 |
| InChI | InChI=1S/C15H18/c1-11-5-4-8-14-9-12-6-2-3-7-13(12)10-15(11)14/h2-3,6-7,9,11,15H,4-5,8,10H2,1H3 |
| InChIKey | HAJHZLAMLUTPQP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |