C12H5N3O — CID 150384710
3-oxo-1H-indene-1,2,2-tricarbonitrile (PubChem CID 150384710) has the molecular formula C12H5N3O and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-oxo-1H-indene-1,2,2-tricarbonitrile.
| Compound Name | 3-oxo-1H-indene-1,2,2-tricarbonitrile |
|---|---|
| PubChem CID | 150384710 |
| Molecular Formula | C12H5N3O |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-oxo-1H-indene-1,2,2-tricarbonitrile |
| SMILES | N#CC1c2ccccc2C(=O)C1(C#N)C#N |
| InChI | InChI=1S/C12H5N3O/c13-5-10-8-3-1-2-4-9(8)11(16)12(10,6-14)7-15/h1-4,10H |
| InChIKey | HALNPOMHBQKLAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |