About 3-oxo-1H-indene-1,2,2-tricarbonitrile
3-oxo-1H-indene-1,2,2-tricarbonitrile (PubChem CID 150384710) has the molecular formula C12H5N3O
and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-oxo-1H-indene-1,2,2-tricarbonitrile.
Molecular Properties
| Compound Name | 3-oxo-1H-indene-1,2,2-tricarbonitrile |
| PubChem CID | 150384710 |
| Molecular Formula | C12H5N3O |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-oxo-1H-indene-1,2,2-tricarbonitrile |
| SMILES | N#CC1c2ccccc2C(=O)C1(C#N)C#N |
| InChI | InChI=1S/C12H5N3O/c13-5-10-8-3-1-2-4-9(8)11(16)12(10,6-14)7-15/h1-4,10H |
| InChIKey | HALNPOMHBQKLAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-oxo-1H-indene-1,2,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-1H-indene-1,2,2-tricarbonitrile?
The IUPAC name of 3-oxo-1H-indene-1,2,2-tricarbonitrile (CID 150384710) is 3-oxo-1H-indene-1,2,2-tricarbonitrile.
What is the SMILES notation for 3-oxo-1H-indene-1,2,2-tricarbonitrile?
The canonical SMILES for 3-oxo-1H-indene-1,2,2-tricarbonitrile is N#CC1c2ccccc2C(=O)C1(C#N)C#N.
What is the InChIKey of 3-oxo-1H-indene-1,2,2-tricarbonitrile?
The InChIKey is HALNPOMHBQKLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5N3O/c13-5-10-8-3-1-2-4-9(8)11(16)12(10,6-14)7-15/h1-4,10H.
What are the key properties of 3-oxo-1H-indene-1,2,2-tricarbonitrile?
3-oxo-1H-indene-1,2,2-tricarbonitrile has a molecular weight of 207.19 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-1H-indene-1,2,2-tricarbonitrile is sourced from PubChem (CID 150384710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).