About N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine
N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 150386456) has the molecular formula C27H33N3O6P2S
and a molecular weight of 589.59 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 150386456 |
| Molecular Formula | C27H33N3O6P2S |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCOP(=O)(OCC)C(Nc1nc(-c2cccc(-c3ccccc3)c2)nc2sccc12)P(=O)(OCC)OCC |
| InChI | InChI=1S/C27H33N3O6P2S/c1-5-33-37(31,34-6-2)27(38(32,35-7-3)36-8-4)30-25-23-17-18-39-26(23)29-24(28-25)22-16-12-15-21(19-22)20-13-10-9-11-14-20/h9-19,27H,5-8H2,1-4H3,(H,28,29,30) |
| InChIKey | HAUGXJKSHSZOBD-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine (CID 150386456) is N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine is CCOP(=O)(OCC)C(Nc1nc(-c2cccc(-c3ccccc3)c2)nc2sccc12)P(=O)(OCC)OCC.
What is the InChIKey of N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is HAUGXJKSHSZOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O6P2S/c1-5-33-37(31,34-6-2)27(38(32,35-7-3)36-8-4)30-25-23-17-18-39-26(23)29-24(28-25)22-16-12-15-21(19-22)20-13-10-9-11-14-20/h9-19,27H,5-8H2,1-4H3,(H,28,29,30).
What are the key properties of N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine?
N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 589.59 g/mol, XLogP of 8.25, 14 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(diethoxyphosphoryl)methyl]-2-(3-phenylphenyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 150386456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).