About N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide
N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide (PubChem CID 15038665) has the molecular formula C19H15N3O5
and a molecular weight of 365.35 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide |
| PubChem CID | 15038665 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide |
| SMILES | C[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H15N3O5/c1-12(17-8-4-6-13-5-2-3-7-18(13)17)20-19(23)14-9-15(21(24)25)11-16(10-14)22(26)27/h2-12H,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | RUUPGHVIODHXRI-GFCCVEGCSA-N |
| XLogP | 4.15 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide?
The IUPAC name of N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide (CID 15038665) is N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide.
What is the SMILES notation for N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide?
The canonical SMILES for N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide is C[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cccc2ccccc12.
What is the InChIKey of N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide?
The InChIKey is RUUPGHVIODHXRI-GFCCVEGCSA-N. The full InChI is InChI=1S/C19H15N3O5/c1-12(17-8-4-6-13-5-2-3-7-18(13)17)20-19(23)14-9-15(21(24)25)11-16(10-14)22(26)27/h2-12H,1H3,(H,20,23)/t12-/m1/s1.
What are the key properties of N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide?
N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide has a molecular weight of 365.35 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-naphthalen-1-ylethyl]-3,5-dinitrobenzamide is sourced from PubChem (CID 15038665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).