C17H16N2O3 — CID 15038913
(3R,4R)-3-hydroxy-2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-3,4-dihydrochromene-6-carbonitrile (PubChem CID 15038913) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (3R,4R)-3-hydroxy-2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3R,4R)-3-hydroxy-2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 15038913 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (3R,4R)-3-hydroxy-2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](c2cccc[n+]2[O-])[C@H]1O |
| InChI | InChI=1S/C17H16N2O3/c1-17(2)16(20)15(13-5-3-4-8-19(13)21)12-9-11(10-18)6-7-14(12)22-17/h3-9,15-16,20H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | YLQHLGXBLFLRRG-HZPDHXFCSA-N |
| XLogP | 1.86 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|