C16H30N6 — CID 150390183
6-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-4-(2,2-dimethylpropyl)-1H-pyrimidine-2,4-diamine (PubChem CID 150390183) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is 6-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-4-(2,2-dimethylpropyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 6-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-4-(2,2-dimethylpropyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 150390183 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 6-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-4-(2,2-dimethylpropyl)-1H-pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)CC1(N)C=C(N2C[C@H]3CCCN[C@H]3C2)NC(N)=N1 |
| InChI | InChI=1S/C16H30N6/c1-15(2,3)10-16(18)7-13(20-14(17)21-16)22-8-11-5-4-6-19-12(11)9-22/h7,11-12,19H,4-6,8-10,18H2,1-3H3,(H3,17,20,21)/t11-,12+,16?/m1/s1 |
| InChIKey | HBNSUUSNTIGOCX-WWMUWCCSSA-N |
| XLogP | 0.52 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |