C13H17N5O3 — CID 150391238
N-[(3S)-2,6-dioxopiperidin-3-yl]-1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 150391238) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]-1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150391238 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | Cn1nc(C(=O)N[C@H]2CCC(=O)NC2=O)c2c1CCNC2 |
| InChI | InChI=1S/C13H17N5O3/c1-18-9-4-5-14-6-7(9)11(17-18)13(21)15-8-2-3-10(19)16-12(8)20/h8,14H,2-6H2,1H3,(H,15,21)(H,16,19,20)/t8-/m0/s1 |
| InChIKey | HBTFWBKPBZUTOJ-QMMMGPOBSA-N |
| XLogP | -1.40 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|