C23H35F5O4 — CID 150391671
2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-1,1-di(propan-2-yloxy)decan-1-ol (PubChem CID 150391671) has the molecular formula C23H35F5O4 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-1,1-di(propan-2-yloxy)decan-1-ol.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-1,1-di(propan-2-yloxy)decan-1-ol |
|---|---|
| PubChem CID | 150391671 |
| Molecular Formula | C23H35F5O4 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-1,1-di(propan-2-yloxy)decan-1-ol |
| SMILES | CCCCCCCCC(COc1c(F)c(F)c(F)c(F)c1F)C(O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C23H35F5O4/c1-6-7-8-9-10-11-12-16(23(29,31-14(2)3)32-15(4)5)13-30-22-20(27)18(25)17(24)19(26)21(22)28/h14-16,29H,6-13H2,1-5H3 |
| InChIKey | HBVLHCKQVVEDLI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|