About 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione
3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione (PubChem CID 15039180) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione.
Molecular Properties
| Compound Name | 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione |
| PubChem CID | 15039180 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione |
| SMILES | Cn1nc(-c2ccccc2)oc1=S |
| InChI | InChI=1S/C9H8N2OS/c1-11-9(13)12-8(10-11)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | IHYKGPXSEWWQBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione?
The IUPAC name of 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione (CID 15039180) is 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione.
What is the SMILES notation for 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione?
The canonical SMILES for 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione is Cn1nc(-c2ccccc2)oc1=S.
What is the InChIKey of 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione?
The InChIKey is IHYKGPXSEWWQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c1-11-9(13)12-8(10-11)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione?
3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione has a molecular weight of 192.24 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-phenyl-1,3,4-oxadiazole-2-thione is sourced from PubChem (CID 15039180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).