C9H15N3O — CID 150393961
4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 150393961) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 150393961 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)C1=CNC2CCCCN2C1 |
| InChI | InChI=1S/C9H15N3O/c10-9(13)7-5-11-8-3-1-2-4-12(8)6-7/h5,8,11H,1-4,6H2,(H2,10,13) |
| InChIKey | HCHJLGNGPDHZIX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |