About 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine
4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine (PubChem CID 150399210) has the molecular formula C11H11F2N5O2
and a molecular weight of 283.24 g/mol. Its IUPAC name is 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine.
Molecular Properties
| Compound Name | 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine |
| PubChem CID | 150399210 |
| Molecular Formula | C11H11F2N5O2 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine |
| SMILES | O=[N+]([O-])c1cnn(C2CC2)c1N1C=CN=CC(F)(F)C1 |
| InChI | InChI=1S/C11H11F2N5O2/c12-11(13)6-14-3-4-16(7-11)10-9(18(19)20)5-15-17(10)8-1-2-8/h3-6,8H,1-2,7H2 |
| InChIKey | HDJZGDZWIKVXOW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine?
The IUPAC name of 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine (CID 150399210) is 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine.
What is the SMILES notation for 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine?
The canonical SMILES for 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine is O=[N+]([O-])c1cnn(C2CC2)c1N1C=CN=CC(F)(F)C1.
What is the InChIKey of 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine?
The InChIKey is HDJZGDZWIKVXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N5O2/c12-11(13)6-14-3-4-16(7-11)10-9(18(19)20)5-15-17(10)8-1-2-8/h3-6,8H,1-2,7H2.
What are the key properties of 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine?
4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine has a molecular weight of 283.24 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-cyclopropyl-4-nitropyrazol-5-yl)-6,6-difluoro-5H-1,4-diazepine is sourced from PubChem (CID 150399210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).