About trityl 2,2,2-trifluoroacetate
trityl 2,2,2-trifluoroacetate (PubChem CID 15040012) has the molecular formula C21H15F3O2
and a molecular weight of 356.34 g/mol. Its IUPAC name is trityl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | trityl 2,2,2-trifluoroacetate |
| PubChem CID | 15040012 |
| Molecular Formula | C21H15F3O2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | trityl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H15F3O2/c22-21(23,24)19(25)26-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RESFKJVKDJYYDQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trityl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trityl 2,2,2-trifluoroacetate?
The IUPAC name of trityl 2,2,2-trifluoroacetate (CID 15040012) is trityl 2,2,2-trifluoroacetate.
What is the SMILES notation for trityl 2,2,2-trifluoroacetate?
The canonical SMILES for trityl 2,2,2-trifluoroacetate is O=C(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of trityl 2,2,2-trifluoroacetate?
The InChIKey is RESFKJVKDJYYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3O2/c22-21(23,24)19(25)26-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of trityl 2,2,2-trifluoroacetate?
trityl 2,2,2-trifluoroacetate has a molecular weight of 356.34 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trityl 2,2,2-trifluoroacetate is sourced from PubChem (CID 15040012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).