C20H24O2S2Si — CID 15040705
methyl (Z)-2,4-bis(phenylsulfanyl)-4-trimethylsilylbut-3-enoate (PubChem CID 15040705) has the molecular formula C20H24O2S2Si and a molecular weight of 388.63 g/mol. Its IUPAC name is methyl (Z)-2,4-bis(phenylsulfanyl)-4-trimethylsilylbut-3-enoate.
| Compound Name | methyl (Z)-2,4-bis(phenylsulfanyl)-4-trimethylsilylbut-3-enoate |
|---|---|
| PubChem CID | 15040705 |
| Molecular Formula | C20H24O2S2Si |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl (Z)-2,4-bis(phenylsulfanyl)-4-trimethylsilylbut-3-enoate |
| SMILES | COC(=O)C(/C=C(\Sc1ccccc1)[Si](C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C20H24O2S2Si/c1-22-20(21)18(23-16-11-7-5-8-12-16)15-19(25(2,3)4)24-17-13-9-6-10-14-17/h5-15,18H,1-4H3/b19-15+ |
| InChIKey | FRUQVBILFBJTTI-XDJHFCHBSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|