C9H12F5N3 — CID 150407449
5-(1,1,2,2,2-pentafluoroethyl)-1-pentyltriazole (PubChem CID 150407449) has the molecular formula C9H12F5N3 and a molecular weight of 257.21 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1-pentyltriazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-pentyltriazole |
|---|---|
| PubChem CID | 150407449 |
| Molecular Formula | C9H12F5N3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-pentyltriazole |
| SMILES | CCCCCn1nncc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5N3/c1-2-3-4-5-17-7(6-15-16-17)8(10,11)9(12,13)14/h6H,2-5H2,1H3 |
| InChIKey | HFBNQAJBXFPYJN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|