C12H20O2 — CID 150408477
2-ethylspiro[1,3-dioxane-4,2'-bicyclo[2.2.1]heptane] (PubChem CID 150408477) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-ethylspiro[1,3-dioxane-4,2'-bicyclo[2.2.1]heptane].
| Compound Name | 2-ethylspiro[1,3-dioxane-4,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 150408477 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-ethylspiro[1,3-dioxane-4,2'-bicyclo[2.2.1]heptane] |
| SMILES | CCC1OCCC2(CC3CCC2C3)O1 |
| InChI | InChI=1S/C12H20O2/c1-2-11-13-6-5-12(14-11)8-9-3-4-10(12)7-9/h9-11H,2-8H2,1H3 |
| InChIKey | HFGZYZNCLXQRNK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |