C14H13N3O4 — CID 15041060
4-[2-(2-methyl-4-oxoquinazolin-3-yl)ethyl]-1,2-oxazolidine-3,5-dione (PubChem CID 15041060) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-[2-(2-methyl-4-oxoquinazolin-3-yl)ethyl]-1,2-oxazolidine-3,5-dione.
| Compound Name | 4-[2-(2-methyl-4-oxoquinazolin-3-yl)ethyl]-1,2-oxazolidine-3,5-dione |
|---|---|
| PubChem CID | 15041060 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-[2-(2-methyl-4-oxoquinazolin-3-yl)ethyl]-1,2-oxazolidine-3,5-dione |
| SMILES | Cc1nc2ccccc2c(=O)n1CCC1C(=O)NOC1=O |
| InChI | InChI=1S/C14H13N3O4/c1-8-15-11-5-3-2-4-9(11)13(19)17(8)7-6-10-12(18)16-21-14(10)20/h2-5,10H,6-7H2,1H3,(H,16,18) |
| InChIKey | VEFTUSAPUCQKDL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|