C41H36FN5O8 — CID 150419870
2-[2-[9-[(2R,3S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluoro-3-hydroxyoxolan-2-yl]-6-oxopurin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 150419870) has the molecular formula C41H36FN5O8 and a molecular weight of 745.76 g/mol. Its IUPAC name is 2-[2-[9-[(2R,3S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluoro-3-hydroxyoxolan-2-yl]-6-oxopurin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[9-[(2R,3S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluoro-3-hydroxyoxolan-2-yl]-6-oxopurin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 150419870 |
| Molecular Formula | C41H36FN5O8 |
| Molecular Weight | 745.76 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | 2-[2-[9-[(2R,3S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluoro-3-hydroxyoxolan-2-yl]-6-oxopurin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)n(CCN5C(=O)c6ccccc6C5=O)cnc43)[C@H](O)[C@@H]2F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H36FN5O8/c1-52-28-16-12-26(13-17-28)41(25-8-4-3-5-9-25,27-14-18-29(53-2)19-15-27)54-22-32-33(42)35(48)40(55-32)47-24-43-34-36(47)44-23-45(39(34)51)20-21-46-37(49)30-10-6-7-11-31(30)38(46)50/h3-19,23-24,32-33,35,40,48H,20-22H2,1-2H3/t32-,33-,35-,40-/m1/s1 |
| InChIKey | HHNUQASLWPLXII-OOYPWMSPSA-N |
| XLogP | 4.51 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|